About 2-(1-fluoroethenyl)-1,4-dioxane
2-(1-fluoroethenyl)-1,4-dioxane (PubChem CID 175052279) has the molecular formula C6H9FO2
and a molecular weight of 132.13 g/mol. Its IUPAC name is 2-(1-fluoroethenyl)-1,4-dioxane.
Molecular Properties
| Compound Name | 2-(1-fluoroethenyl)-1,4-dioxane |
| PubChem CID | 175052279 |
| Molecular Formula | C6H9FO2 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 2-(1-fluoroethenyl)-1,4-dioxane |
| SMILES | C=C(F)C1COCCO1 |
| InChI | InChI=1S/C6H9FO2/c1-5(7)6-4-8-2-3-9-6/h6H,1-4H2 |
| InChIKey | UAQWBDBVPVKVAF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-fluoroethenyl)-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-fluoroethenyl)-1,4-dioxane?
The IUPAC name of 2-(1-fluoroethenyl)-1,4-dioxane (CID 175052279) is 2-(1-fluoroethenyl)-1,4-dioxane.
What is the SMILES notation for 2-(1-fluoroethenyl)-1,4-dioxane?
The canonical SMILES for 2-(1-fluoroethenyl)-1,4-dioxane is C=C(F)C1COCCO1.
What is the InChIKey of 2-(1-fluoroethenyl)-1,4-dioxane?
The InChIKey is UAQWBDBVPVKVAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FO2/c1-5(7)6-4-8-2-3-9-6/h6H,1-4H2.
What are the key properties of 2-(1-fluoroethenyl)-1,4-dioxane?
2-(1-fluoroethenyl)-1,4-dioxane has a molecular weight of 132.13 g/mol, XLogP of 0.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-fluoroethenyl)-1,4-dioxane is sourced from PubChem (CID 175052279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).