About 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile
6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile (PubChem CID 175052767) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile |
| PubChem CID | 175052767 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile |
| SMILES | COC1(N)C=CC=C(c2ccccc2)C1C#N |
| InChI | InChI=1S/C14H14N2O/c1-17-14(16)9-5-8-12(13(14)10-15)11-6-3-2-4-7-11/h2-9,13H,16H2,1H3 |
| InChIKey | MJFJVUVTQAJNKZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile?
The IUPAC name of 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile (CID 175052767) is 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile.
What is the SMILES notation for 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile?
The canonical SMILES for 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile is COC1(N)C=CC=C(c2ccccc2)C1C#N.
What is the InChIKey of 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile?
The InChIKey is MJFJVUVTQAJNKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O/c1-17-14(16)9-5-8-12(13(14)10-15)11-6-3-2-4-7-11/h2-9,13H,16H2,1H3.
What are the key properties of 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile?
6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile has a molecular weight of 226.28 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-6-methoxy-2-phenylcyclohexa-2,4-diene-1-carbonitrile is sourced from PubChem (CID 175052767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).