About benzo[e][1]benzofuran;1,3-dihydroindol-2-one
benzo[e][1]benzofuran;1,3-dihydroindol-2-one (PubChem CID 175053136) has the molecular formula C20H15NO2
and a molecular weight of 301.35 g/mol. Its IUPAC name is benzo[e][1]benzofuran;1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | benzo[e][1]benzofuran;1,3-dihydroindol-2-one |
| PubChem CID | 175053136 |
| Molecular Formula | C20H15NO2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | benzo[e][1]benzofuran;1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2ccccc2N1.c1ccc2c(c1)ccc1occc12 |
| InChI | InChI=1S/C12H8O.C8H7NO/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12;10-8-5-6-3-1-2-4-7(6)9-8/h1-8H;1-4H,5H2,(H,9,10) |
| InChIKey | BRJJWWUXLLNHJW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[e][1]benzofuran;1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[e][1]benzofuran;1,3-dihydroindol-2-one?
The IUPAC name of benzo[e][1]benzofuran;1,3-dihydroindol-2-one (CID 175053136) is benzo[e][1]benzofuran;1,3-dihydroindol-2-one.
What is the SMILES notation for benzo[e][1]benzofuran;1,3-dihydroindol-2-one?
The canonical SMILES for benzo[e][1]benzofuran;1,3-dihydroindol-2-one is O=C1Cc2ccccc2N1.c1ccc2c(c1)ccc1occc12.
What is the InChIKey of benzo[e][1]benzofuran;1,3-dihydroindol-2-one?
The InChIKey is BRJJWWUXLLNHJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O.C8H7NO/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12;10-8-5-6-3-1-2-4-7(6)9-8/h1-8H;1-4H,5H2,(H,9,10).
What are the key properties of benzo[e][1]benzofuran;1,3-dihydroindol-2-one?
benzo[e][1]benzofuran;1,3-dihydroindol-2-one has a molecular weight of 301.35 g/mol, XLogP of 4.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[e][1]benzofuran;1,3-dihydroindol-2-one is sourced from PubChem (CID 175053136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).