C10H21NO3 — CID 175053387
1-methoxy-2,2,6,6-tetramethylpiperidine-3,4-diol (PubChem CID 175053387) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-methoxy-2,2,6,6-tetramethylpiperidine-3,4-diol.
| Compound Name | 1-methoxy-2,2,6,6-tetramethylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 175053387 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 1-methoxy-2,2,6,6-tetramethylpiperidine-3,4-diol |
| SMILES | CON1C(C)(C)CC(O)C(O)C1(C)C |
| InChI | InChI=1S/C10H21NO3/c1-9(2)6-7(12)8(13)10(3,4)11(9)14-5/h7-8,12-13H,6H2,1-5H3 |
| InChIKey | VXOXSWXCQRMAKP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |