C16H19NO2 — CID 175053393
4-[4-(cyclopentylmethyl)-3-methyl-1,2-oxazol-5-yl]phenol (PubChem CID 175053393) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-[4-(cyclopentylmethyl)-3-methyl-1,2-oxazol-5-yl]phenol.
| Compound Name | 4-[4-(cyclopentylmethyl)-3-methyl-1,2-oxazol-5-yl]phenol |
|---|---|
| PubChem CID | 175053393 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-[4-(cyclopentylmethyl)-3-methyl-1,2-oxazol-5-yl]phenol |
| SMILES | Cc1noc(-c2ccc(O)cc2)c1CC1CCCC1 |
| InChI | InChI=1S/C16H19NO2/c1-11-15(10-12-4-2-3-5-12)16(19-17-11)13-6-8-14(18)9-7-13/h6-9,12,18H,2-5,10H2,1H3 |
| InChIKey | VFHQEAGNSJERTG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |