C17H28BNO2 — CID 175054044
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carbonitrile (PubChem CID 175054044) has the molecular formula C17H28BNO2 and a molecular weight of 289.23 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carbonitrile.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 175054044 |
| Molecular Formula | C17H28BNO2 |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carbonitrile |
| SMILES | CC1(C)OB(C2CCC(C#N)C3CCCCC23)OC1(C)C |
| InChI | InChI=1S/C17H28BNO2/c1-16(2)17(3,4)21-18(20-16)15-10-9-12(11-19)13-7-5-6-8-14(13)15/h12-15H,5-10H2,1-4H3 |
| InChIKey | XTBMRXWWBQFTIX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|