C17H14N2O — CID 175054569
3-[(4-ethenylphenyl)methyl]-5-pyridin-3-yl-1,2-oxazole (PubChem CID 175054569) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-[(4-ethenylphenyl)methyl]-5-pyridin-3-yl-1,2-oxazole.
| Compound Name | 3-[(4-ethenylphenyl)methyl]-5-pyridin-3-yl-1,2-oxazole |
|---|---|
| PubChem CID | 175054569 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3-[(4-ethenylphenyl)methyl]-5-pyridin-3-yl-1,2-oxazole |
| SMILES | C=Cc1ccc(Cc2cc(-c3cccnc3)on2)cc1 |
| InChI | InChI=1S/C17H14N2O/c1-2-13-5-7-14(8-6-13)10-16-11-17(20-19-16)15-4-3-9-18-12-15/h2-9,11-12H,1,10H2 |
| InChIKey | LKLMLQMWTMRAGQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |