About magnesium;1-bromo-2-chlorobenzene;dichloride
magnesium;1-bromo-2-chlorobenzene;dichloride (PubChem CID 175054849) has the molecular formula C6H4BrCl3Mg
and a molecular weight of 286.67 g/mol. Its IUPAC name is magnesium;1-bromo-2-chlorobenzene;dichloride.
Molecular Properties
| Compound Name | magnesium;1-bromo-2-chlorobenzene;dichloride |
|---|
| PubChem CID | 175054849 |
|---|
| Molecular Formula | C6H4BrCl3Mg |
|---|
| Molecular Weight | 286.67 g/mol |
|---|
| Exact Mass | 283.84 |
|---|
| IUPAC Name | magnesium;1-bromo-2-chlorobenzene;dichloride |
|---|
| SMILES | Clc1ccccc1Br.[Cl-].[Cl-].[Mg+2] |
|---|
| InChI | InChI=1S/C6H4BrCl.2ClH.Mg/c7-5-3-1-2-4-6(5)8;;;/h1-4H;2*1H;/q;;;+2/p-2 |
|---|
| InChIKey | KGNNCCXBJZJISC-UHFFFAOYSA-L |
|---|
| XLogP | -3.27 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 11 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze magnesium;1-bromo-2-chlorobenzene;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1-bromo-2-chlorobenzene;dichloride?
The IUPAC name of magnesium;1-bromo-2-chlorobenzene;dichloride (CID 175054849) is magnesium;1-bromo-2-chlorobenzene;dichloride.
What is the SMILES notation for magnesium;1-bromo-2-chlorobenzene;dichloride?
The canonical SMILES for magnesium;1-bromo-2-chlorobenzene;dichloride is Clc1ccccc1Br.[Cl-].[Cl-].[Mg+2].
What is the InChIKey of magnesium;1-bromo-2-chlorobenzene;dichloride?
The InChIKey is KGNNCCXBJZJISC-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H4BrCl.2ClH.Mg/c7-5-3-1-2-4-6(5)8;;;/h1-4H;2*1H;/q;;;+2/p-2.
What are the key properties of magnesium;1-bromo-2-chlorobenzene;dichloride?
magnesium;1-bromo-2-chlorobenzene;dichloride has a molecular weight of 286.67 g/mol, XLogP of -3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1-bromo-2-chlorobenzene;dichloride is sourced from PubChem (CID 175054849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).