C26H39BFN3O4 — CID 175055009
tert-butyl N-[[4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-(4-methylcyclohexyl)methyl]carbamate (PubChem CID 175055009) has the molecular formula C26H39BFN3O4 and a molecular weight of 487.43 g/mol. Its IUPAC name is tert-butyl N-[[4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-(4-methylcyclohexyl)methyl]carbamate.
| Compound Name | tert-butyl N-[[4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-(4-methylcyclohexyl)methyl]carbamate |
|---|---|
| PubChem CID | 175055009 |
| Molecular Formula | C26H39BFN3O4 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | tert-butyl N-[[4-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-yl]-(4-methylcyclohexyl)methyl]carbamate |
| SMILES | CC1CCC(C(NC(=O)OC(C)(C)C)c2nc3c(F)c(B4OC(C)(C)C(C)(C)O4)ccc3[nH]2)CC1 |
| InChI | InChI=1S/C26H39BFN3O4/c1-15-9-11-16(12-10-15)20(31-23(32)33-24(2,3)4)22-29-18-14-13-17(19(28)21(18)30-22)27-34-25(5,6)26(7,8)35-27/h13-16,20H,9-12H2,1-8H3,(H,29,30)(H,31,32) |
| InChIKey | QGJWPARSCFLUDN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|