About 3,3-difluoropyrrolidine-2,5-dione
3,3-difluoropyrrolidine-2,5-dione (PubChem CID 175055206) has the molecular formula C4H3F2NO2
and a molecular weight of 135.07 g/mol. Its IUPAC name is 3,3-difluoropyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3,3-difluoropyrrolidine-2,5-dione |
| PubChem CID | 175055206 |
| Molecular Formula | C4H3F2NO2 |
| Molecular Weight | 135.07 g/mol |
| Exact Mass | 135.01 |
| IUPAC Name | 3,3-difluoropyrrolidine-2,5-dione |
| SMILES | O=C1CC(F)(F)C(=O)N1 |
| InChI | InChI=1S/C4H3F2NO2/c5-4(6)1-2(8)7-3(4)9/h1H2,(H,7,8,9) |
| InChIKey | VLRWDPNXTISXHW-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.07 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,3-difluoropyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoropyrrolidine-2,5-dione?
The IUPAC name of 3,3-difluoropyrrolidine-2,5-dione (CID 175055206) is 3,3-difluoropyrrolidine-2,5-dione.
What is the SMILES notation for 3,3-difluoropyrrolidine-2,5-dione?
The canonical SMILES for 3,3-difluoropyrrolidine-2,5-dione is O=C1CC(F)(F)C(=O)N1.
What is the InChIKey of 3,3-difluoropyrrolidine-2,5-dione?
The InChIKey is VLRWDPNXTISXHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3F2NO2/c5-4(6)1-2(8)7-3(4)9/h1H2,(H,7,8,9).
What are the key properties of 3,3-difluoropyrrolidine-2,5-dione?
3,3-difluoropyrrolidine-2,5-dione has a molecular weight of 135.07 g/mol, XLogP of -0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoropyrrolidine-2,5-dione is sourced from PubChem (CID 175055206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).