About N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide
N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide (PubChem CID 175055981) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide |
| PubChem CID | 175055981 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CC2(CNc3ccccc32)C1=O |
| InChI | InChI=1S/C15H19N3O2/c1-14(2,3)17-13(20)18-9-15(12(18)19)8-16-11-7-5-4-6-10(11)15/h4-7,16H,8-9H2,1-3H3,(H,17,20) |
| InChIKey | KXAWPMJJLSRQMW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide?
The IUPAC name of N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide (CID 175055981) is N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide.
What is the SMILES notation for N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide?
The canonical SMILES for N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide is CC(C)(C)NC(=O)N1CC2(CNc3ccccc32)C1=O.
What is the InChIKey of N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide?
The InChIKey is KXAWPMJJLSRQMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-14(2,3)17-13(20)18-9-15(12(18)19)8-16-11-7-5-4-6-10(11)15/h4-7,16H,8-9H2,1-3H3,(H,17,20).
What are the key properties of N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide?
N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide has a molecular weight of 273.34 g/mol, XLogP of 1.70, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2'-oxospiro[1,2-dihydroindole-3,3'-azetidine]-1'-carboxamide is sourced from PubChem (CID 175055981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).