C15H26F2O2 — CID 175057000
undecyl 3,3-difluoro-2-methylprop-2-enoate (PubChem CID 175057000) has the molecular formula C15H26F2O2 and a molecular weight of 276.37 g/mol. Its IUPAC name is undecyl 3,3-difluoro-2-methylprop-2-enoate.
| Compound Name | undecyl 3,3-difluoro-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175057000 |
| Molecular Formula | C15H26F2O2 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | undecyl 3,3-difluoro-2-methylprop-2-enoate |
| SMILES | CCCCCCCCCCCOC(=O)C(C)=C(F)F |
| InChI | InChI=1S/C15H26F2O2/c1-3-4-5-6-7-8-9-10-11-12-19-15(18)13(2)14(16)17/h3-12H2,1-2H3 |
| InChIKey | LTYHOCRLUGJUGE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|