C35H42NOPS — CID 175057623
tert-butyl-[[(S)-(4-tert-butylphenyl)-[(4S)-4,5-dimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]methyl]amino]-oxidosulfanium (PubChem CID 175057623) has the molecular formula C35H42NOPS and a molecular weight of 555.77 g/mol. Its IUPAC name is tert-butyl-[[(S)-(4-tert-butylphenyl)-[(4S)-4,5-dimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]methyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(S)-(4-tert-butylphenyl)-[(4S)-4,5-dimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]methyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175057623 |
| Molecular Formula | C35H42NOPS |
| Molecular Weight | 555.77 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | tert-butyl-[[(S)-(4-tert-butylphenyl)-[(4S)-4,5-dimethyl-3,6-diphenyl-1-phosphabicyclo[2.2.1]hepta-2,5-dien-2-yl]methyl]amino]-oxidosulfanium |
| SMILES | CC1=C(c2ccccc2)[P@]2C[C@]1(C)C(c1ccccc1)=C2[C@@H](N[S+]([O-])C(C)(C)C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H42NOPS/c1-24-31(27-17-13-10-14-18-27)38-23-35(24,8)29(25-15-11-9-12-16-25)32(38)30(36-39(37)34(5,6)7)26-19-21-28(22-20-26)33(2,3)4/h9-22,30,36H,23H2,1-8H3/t30-,35-,38-,39?/m0/s1 |
| InChIKey | QVRVFPQBZXAARP-WDYDYKDFSA-N |
| XLogP | 9.43 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.77 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|