About 4,5-diethyl-2-methylsulfanylpyrimidine;formamide
4,5-diethyl-2-methylsulfanylpyrimidine;formamide (PubChem CID 175057722) has the molecular formula C10H17N3OS
and a molecular weight of 227.33 g/mol. Its IUPAC name is 4,5-diethyl-2-methylsulfanylpyrimidine;formamide.
Molecular Properties
| Compound Name | 4,5-diethyl-2-methylsulfanylpyrimidine;formamide |
| PubChem CID | 175057722 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4,5-diethyl-2-methylsulfanylpyrimidine;formamide |
| SMILES | CCc1cnc(SC)nc1CC.NC=O |
| InChI | InChI=1S/C9H14N2S.CH3NO/c1-4-7-6-10-9(12-3)11-8(7)5-2;2-1-3/h6H,4-5H2,1-3H3;1H,(H2,2,3) |
| InChIKey | JVDVZYACJZBZSQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diethyl-2-methylsulfanylpyrimidine;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethyl-2-methylsulfanylpyrimidine;formamide?
The IUPAC name of 4,5-diethyl-2-methylsulfanylpyrimidine;formamide (CID 175057722) is 4,5-diethyl-2-methylsulfanylpyrimidine;formamide.
What is the SMILES notation for 4,5-diethyl-2-methylsulfanylpyrimidine;formamide?
The canonical SMILES for 4,5-diethyl-2-methylsulfanylpyrimidine;formamide is CCc1cnc(SC)nc1CC.NC=O.
What is the InChIKey of 4,5-diethyl-2-methylsulfanylpyrimidine;formamide?
The InChIKey is JVDVZYACJZBZSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2S.CH3NO/c1-4-7-6-10-9(12-3)11-8(7)5-2;2-1-3/h6H,4-5H2,1-3H3;1H,(H2,2,3).
What are the key properties of 4,5-diethyl-2-methylsulfanylpyrimidine;formamide?
4,5-diethyl-2-methylsulfanylpyrimidine;formamide has a molecular weight of 227.33 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethyl-2-methylsulfanylpyrimidine;formamide is sourced from PubChem (CID 175057722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).