About lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide
lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide (PubChem CID 175057873) has the molecular formula C5H11F3LiNO3S
and a molecular weight of 229.15 g/mol. Its IUPAC name is lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide.
Molecular Properties
| Compound Name | lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide |
| PubChem CID | 175057873 |
| Molecular Formula | C5H11F3LiNO3S |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide |
| SMILES | O=S(=O)(NCCCCO)C(F)(F)F.[H-].[Li+] |
| InChI | InChI=1S/C5H10F3NO3S.Li.H/c6-5(7,8)13(11,12)9-3-1-2-4-10;;/h9-10H,1-4H2;;/q;+1;-1 |
| InChIKey | AKZHDKOXWRDNEA-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide?
The IUPAC name of lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide (CID 175057873) is lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide.
What is the SMILES notation for lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide?
The canonical SMILES for lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide is O=S(=O)(NCCCCO)C(F)(F)F.[H-].[Li+].
What is the InChIKey of lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide?
The InChIKey is AKZHDKOXWRDNEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F3NO3S.Li.H/c6-5(7,8)13(11,12)9-3-1-2-4-10;;/h9-10H,1-4H2;;/q;+1;-1.
What are the key properties of lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide?
lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide has a molecular weight of 229.15 g/mol, XLogP of -2.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;1,1,1-trifluoro-N-(4-hydroxybutyl)methanesulfonamide is sourced from PubChem (CID 175057873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).