C18H24F2N4O — CID 175058042
3-(2,2-difluoroethyl)-1-[6-(2,5-dimethylpyrrol-1-yl)-4-methoxy-3-pyridinyl]piperazine (PubChem CID 175058042) has the molecular formula C18H24F2N4O and a molecular weight of 350.41 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-1-[6-(2,5-dimethylpyrrol-1-yl)-4-methoxy-3-pyridinyl]piperazine.
| Compound Name | 3-(2,2-difluoroethyl)-1-[6-(2,5-dimethylpyrrol-1-yl)-4-methoxy-3-pyridinyl]piperazine |
|---|---|
| PubChem CID | 175058042 |
| Molecular Formula | C18H24F2N4O |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 3-(2,2-difluoroethyl)-1-[6-(2,5-dimethylpyrrol-1-yl)-4-methoxy-3-pyridinyl]piperazine |
| SMILES | COc1cc(-n2c(C)ccc2C)ncc1N1CCNC(CC(F)F)C1 |
| InChI | InChI=1S/C18H24F2N4O/c1-12-4-5-13(2)24(12)18-9-16(25-3)15(10-22-18)23-7-6-21-14(11-23)8-17(19)20/h4-5,9-10,14,17,21H,6-8,11H2,1-3H3 |
| InChIKey | FEFWAXPWGBITLI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|