About hydroxycarbamoyl 2-(2-chloroanilino)acetate
hydroxycarbamoyl 2-(2-chloroanilino)acetate (PubChem CID 175058380) has the molecular formula C9H9ClN2O4
and a molecular weight of 244.63 g/mol. Its IUPAC name is hydroxycarbamoyl 2-(2-chloroanilino)acetate.
Molecular Properties
| Compound Name | hydroxycarbamoyl 2-(2-chloroanilino)acetate |
| PubChem CID | 175058380 |
| Molecular Formula | C9H9ClN2O4 |
| Molecular Weight | 244.63 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | hydroxycarbamoyl 2-(2-chloroanilino)acetate |
| SMILES | O=C(CNc1ccccc1Cl)OC(=O)NO |
| InChI | InChI=1S/C9H9ClN2O4/c10-6-3-1-2-4-7(6)11-5-8(13)16-9(14)12-15/h1-4,11,15H,5H2,(H,12,14) |
| InChIKey | AKIBSBWPRWLYJO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.63 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxycarbamoyl 2-(2-chloroanilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxycarbamoyl 2-(2-chloroanilino)acetate?
The IUPAC name of hydroxycarbamoyl 2-(2-chloroanilino)acetate (CID 175058380) is hydroxycarbamoyl 2-(2-chloroanilino)acetate.
What is the SMILES notation for hydroxycarbamoyl 2-(2-chloroanilino)acetate?
The canonical SMILES for hydroxycarbamoyl 2-(2-chloroanilino)acetate is O=C(CNc1ccccc1Cl)OC(=O)NO.
What is the InChIKey of hydroxycarbamoyl 2-(2-chloroanilino)acetate?
The InChIKey is AKIBSBWPRWLYJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2O4/c10-6-3-1-2-4-7(6)11-5-8(13)16-9(14)12-15/h1-4,11,15H,5H2,(H,12,14).
What are the key properties of hydroxycarbamoyl 2-(2-chloroanilino)acetate?
hydroxycarbamoyl 2-(2-chloroanilino)acetate has a molecular weight of 244.63 g/mol, XLogP of 1.39, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxycarbamoyl 2-(2-chloroanilino)acetate is sourced from PubChem (CID 175058380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).