About 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one
6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one (PubChem CID 175058457) has the molecular formula C16H12O3
and a molecular weight of 252.27 g/mol. Its IUPAC name is 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one.
Molecular Properties
| Compound Name | 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one |
| PubChem CID | 175058457 |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one |
| SMILES | O=C1c2ccccc2OC2OCc3ccccc3C12 |
| InChI | InChI=1S/C16H12O3/c17-15-12-7-3-4-8-13(12)19-16-14(15)11-6-2-1-5-10(11)9-18-16/h1-8,14,16H,9H2 |
| InChIKey | YDCUVKIJLZLJPP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one?
The IUPAC name of 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one (CID 175058457) is 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one.
What is the SMILES notation for 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one?
The canonical SMILES for 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one is O=C1c2ccccc2OC2OCc3ccccc3C12.
What is the InChIKey of 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one?
The InChIKey is YDCUVKIJLZLJPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O3/c17-15-12-7-3-4-8-13(12)19-16-14(15)11-6-2-1-5-10(11)9-18-16/h1-8,14,16H,9H2.
What are the key properties of 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one?
6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one has a molecular weight of 252.27 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6a,12a-dihydro-5H-isochromeno[3,4-b]chromen-12-one is sourced from PubChem (CID 175058457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).