About lithium 2-pyridin-2-ylpropanoate
lithium 2-pyridin-2-ylpropanoate (PubChem CID 175058549) has the molecular formula C8H8LiNO2
and a molecular weight of 157.10 g/mol. Its IUPAC name is lithium 2-pyridin-2-ylpropanoate.
Molecular Properties
| Compound Name | lithium 2-pyridin-2-ylpropanoate |
| PubChem CID | 175058549 |
| Molecular Formula | C8H8LiNO2 |
| Molecular Weight | 157.10 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | lithium 2-pyridin-2-ylpropanoate |
| SMILES | CC(C(=O)[O-])c1ccccn1.[Li+] |
| InChI | InChI=1S/C8H9NO2.Li/c1-6(8(10)11)7-4-2-3-5-9-7;/h2-6H,1H3,(H,10,11);/q;+1/p-1 |
| InChIKey | QSNXGFYOMBCBSS-UHFFFAOYSA-M |
| XLogP | -3.06 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.10 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium 2-pyridin-2-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-pyridin-2-ylpropanoate?
The IUPAC name of lithium 2-pyridin-2-ylpropanoate (CID 175058549) is lithium 2-pyridin-2-ylpropanoate.
What is the SMILES notation for lithium 2-pyridin-2-ylpropanoate?
The canonical SMILES for lithium 2-pyridin-2-ylpropanoate is CC(C(=O)[O-])c1ccccn1.[Li+].
What is the InChIKey of lithium 2-pyridin-2-ylpropanoate?
The InChIKey is QSNXGFYOMBCBSS-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9NO2.Li/c1-6(8(10)11)7-4-2-3-5-9-7;/h2-6H,1H3,(H,10,11);/q;+1/p-1.
What are the key properties of lithium 2-pyridin-2-ylpropanoate?
lithium 2-pyridin-2-ylpropanoate has a molecular weight of 157.10 g/mol, XLogP of -3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-pyridin-2-ylpropanoate is sourced from PubChem (CID 175058549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).