About 3,4,5-trifluorothian-2-ol
3,4,5-trifluorothian-2-ol (PubChem CID 175058582) has the molecular formula C5H7F3OS
and a molecular weight of 172.17 g/mol. Its IUPAC name is 3,4,5-trifluorothian-2-ol.
Molecular Properties
| Compound Name | 3,4,5-trifluorothian-2-ol |
| PubChem CID | 175058582 |
| Molecular Formula | C5H7F3OS |
| Molecular Weight | 172.17 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | 3,4,5-trifluorothian-2-ol |
| SMILES | OC1SCC(F)C(F)C1F |
| InChI | InChI=1S/C5H7F3OS/c6-2-1-10-5(9)4(8)3(2)7/h2-5,9H,1H2 |
| InChIKey | BOLHFICPORGQKE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.17 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4,5-trifluorothian-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trifluorothian-2-ol?
The IUPAC name of 3,4,5-trifluorothian-2-ol (CID 175058582) is 3,4,5-trifluorothian-2-ol.
What is the SMILES notation for 3,4,5-trifluorothian-2-ol?
The canonical SMILES for 3,4,5-trifluorothian-2-ol is OC1SCC(F)C(F)C1F.
What is the InChIKey of 3,4,5-trifluorothian-2-ol?
The InChIKey is BOLHFICPORGQKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F3OS/c6-2-1-10-5(9)4(8)3(2)7/h2-5,9H,1H2.
What are the key properties of 3,4,5-trifluorothian-2-ol?
3,4,5-trifluorothian-2-ol has a molecular weight of 172.17 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trifluorothian-2-ol is sourced from PubChem (CID 175058582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).