About 1H-indazole;9H-xanthen-1-amine
1H-indazole;9H-xanthen-1-amine (PubChem CID 175059055) has the molecular formula C20H17N3O
and a molecular weight of 315.38 g/mol. Its IUPAC name is 1H-indazole;9H-xanthen-1-amine.
Molecular Properties
| Compound Name | 1H-indazole;9H-xanthen-1-amine |
| PubChem CID | 175059055 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1H-indazole;9H-xanthen-1-amine |
| SMILES | Nc1cccc2c1Cc1ccccc1O2.c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C13H11NO.C7H6N2/c14-11-5-3-7-13-10(11)8-9-4-1-2-6-12(9)15-13;1-2-4-7-6(3-1)5-8-9-7/h1-7H,8,14H2;1-5H,(H,8,9) |
| InChIKey | LJCUDWPJFMYYTI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1H-indazole;9H-xanthen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole;9H-xanthen-1-amine?
The IUPAC name of 1H-indazole;9H-xanthen-1-amine (CID 175059055) is 1H-indazole;9H-xanthen-1-amine.
What is the SMILES notation for 1H-indazole;9H-xanthen-1-amine?
The canonical SMILES for 1H-indazole;9H-xanthen-1-amine is Nc1cccc2c1Cc1ccccc1O2.c1ccc2[nH]ncc2c1.
What is the InChIKey of 1H-indazole;9H-xanthen-1-amine?
The InChIKey is LJCUDWPJFMYYTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO.C7H6N2/c14-11-5-3-7-13-10(11)8-9-4-1-2-6-12(9)15-13;1-2-4-7-6(3-1)5-8-9-7/h1-7H,8,14H2;1-5H,(H,8,9).
What are the key properties of 1H-indazole;9H-xanthen-1-amine?
1H-indazole;9H-xanthen-1-amine has a molecular weight of 315.38 g/mol, XLogP of 4.53, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole;9H-xanthen-1-amine is sourced from PubChem (CID 175059055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).