About 1,2-dimethylimidazolidine;formamide
1,2-dimethylimidazolidine;formamide (PubChem CID 175059210) has the molecular formula C6H15N3O
and a molecular weight of 145.21 g/mol. Its IUPAC name is 1,2-dimethylimidazolidine;formamide.
Molecular Properties
| Compound Name | 1,2-dimethylimidazolidine;formamide |
| PubChem CID | 175059210 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 1,2-dimethylimidazolidine;formamide |
| SMILES | CC1NCCN1C.NC=O |
| InChI | InChI=1S/C5H12N2.CH3NO/c1-5-6-3-4-7(5)2;2-1-3/h5-6H,3-4H2,1-2H3;1H,(H2,2,3) |
| InChIKey | LKZPRMZGCRPDAQ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylimidazolidine;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylimidazolidine;formamide?
The IUPAC name of 1,2-dimethylimidazolidine;formamide (CID 175059210) is 1,2-dimethylimidazolidine;formamide.
What is the SMILES notation for 1,2-dimethylimidazolidine;formamide?
The canonical SMILES for 1,2-dimethylimidazolidine;formamide is CC1NCCN1C.NC=O.
What is the InChIKey of 1,2-dimethylimidazolidine;formamide?
The InChIKey is LKZPRMZGCRPDAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2.CH3NO/c1-5-6-3-4-7(5)2;2-1-3/h5-6H,3-4H2,1-2H3;1H,(H2,2,3).
What are the key properties of 1,2-dimethylimidazolidine;formamide?
1,2-dimethylimidazolidine;formamide has a molecular weight of 145.21 g/mol, XLogP of -1.03, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylimidazolidine;formamide is sourced from PubChem (CID 175059210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).