About 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine
5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine (PubChem CID 175060030) has the molecular formula C10H9F3N2
and a molecular weight of 214.19 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine.
Molecular Properties
| Compound Name | 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine |
| PubChem CID | 175060030 |
| Molecular Formula | C10H9F3N2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine |
| SMILES | FC(F)(F)C1=NCCNc2ccccc21 |
| InChI | InChI=1S/C10H9F3N2/c11-10(12,13)9-7-3-1-2-4-8(7)14-5-6-15-9/h1-4,14H,5-6H2 |
| InChIKey | MSZVARIKPKDRGS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine?
The IUPAC name of 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine (CID 175060030) is 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine.
What is the SMILES notation for 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine?
The canonical SMILES for 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine is FC(F)(F)C1=NCCNc2ccccc21.
What is the InChIKey of 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine?
The InChIKey is MSZVARIKPKDRGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2/c11-10(12,13)9-7-3-1-2-4-8(7)14-5-6-15-9/h1-4,14H,5-6H2.
What are the key properties of 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine?
5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine has a molecular weight of 214.19 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)-2,3-dihydro-1H-1,4-benzodiazepine is sourced from PubChem (CID 175060030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).