About 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid
4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid (PubChem CID 175060384) has the molecular formula C10H18F3N3O6S2
and a molecular weight of 397.40 g/mol. Its IUPAC name is 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid |
| PubChem CID | 175060384 |
| Molecular Formula | C10H18F3N3O6S2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid |
| SMILES | CC(N)c1nccn1CCCCS(=O)(=O)O.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C9H17N3O3S.CHF3O3S/c1-8(10)9-11-4-6-12(9)5-2-3-7-16(13,14)15;2-1(3,4)8(5,6)7/h4,6,8H,2-3,5,7,10H2,1H3,(H,13,14,15);(H,5,6,7) |
| InChIKey | KDCGAMPYMURNCV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid?
The IUPAC name of 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid (CID 175060384) is 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid.
What is the SMILES notation for 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid?
The canonical SMILES for 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid is CC(N)c1nccn1CCCCS(=O)(=O)O.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid?
The InChIKey is KDCGAMPYMURNCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O3S.CHF3O3S/c1-8(10)9-11-4-6-12(9)5-2-3-7-16(13,14)15;2-1(3,4)8(5,6)7/h4,6,8H,2-3,5,7,10H2,1H3,(H,13,14,15);(H,5,6,7).
What are the key properties of 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid?
4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid has a molecular weight of 397.40 g/mol, XLogP of 0.96, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1-aminoethyl)imidazol-1-yl]butane-1-sulfonic acid;trifluoromethanesulfonic acid is sourced from PubChem (CID 175060384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).