C8H16FNO3 — CID 175060409
2-[fluoro(methyl)amino]-3-hydroxy-2,3-dimethylpentanoic acid (PubChem CID 175060409) has the molecular formula C8H16FNO3 and a molecular weight of 193.22 g/mol. Its IUPAC name is 2-[fluoro(methyl)amino]-3-hydroxy-2,3-dimethylpentanoic acid.
| Compound Name | 2-[fluoro(methyl)amino]-3-hydroxy-2,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 175060409 |
| Molecular Formula | C8H16FNO3 |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-[fluoro(methyl)amino]-3-hydroxy-2,3-dimethylpentanoic acid |
| SMILES | CCC(C)(O)C(C)(C(=O)O)N(C)F |
| InChI | InChI=1S/C8H16FNO3/c1-5-7(2,13)8(3,6(11)12)10(4)9/h13H,5H2,1-4H3,(H,11,12) |
| InChIKey | JMMKZUJJEZEZHV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|