About acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid
acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid (PubChem CID 175060887) has the molecular formula C10H23AlO4
and a molecular weight of 234.27 g/mol. Its IUPAC name is acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid.
Molecular Properties
| Compound Name | acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid |
| PubChem CID | 175060887 |
| Molecular Formula | C10H23AlO4 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid |
| SMILES | CC(=O)O.CC(C)C(C(=O)O)C(C)C.[AlH3] |
| InChI | InChI=1S/C8H16O2.C2H4O2.Al.3H/c1-5(2)7(6(3)4)8(9)10;1-2(3)4;;;;/h5-7H,1-4H3,(H,9,10);1H3,(H,3,4);;;; |
| InChIKey | JNQILRIFELGEKQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid?
The IUPAC name of acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid (CID 175060887) is acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid.
What is the SMILES notation for acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid?
The canonical SMILES for acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid is CC(=O)O.CC(C)C(C(=O)O)C(C)C.[AlH3].
What is the InChIKey of acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid?
The InChIKey is JNQILRIFELGEKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C2H4O2.Al.3H/c1-5(2)7(6(3)4)8(9)10;1-2(3)4;;;;/h5-7H,1-4H3,(H,9,10);1H3,(H,3,4);;;;.
What are the key properties of acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid?
acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid has a molecular weight of 234.27 g/mol, XLogP of 0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;alumane;3-methyl-2-propan-2-ylbutanoic acid is sourced from PubChem (CID 175060887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).