About bis(antimony(3+));N,N,2-tribromoaniline;hexachloride
bis(antimony(3+));N,N,2-tribromoaniline;hexachloride (PubChem CID 175061094) has the molecular formula C6H4Br3Cl6NSb2
and a molecular weight of 786.05 g/mol. Its IUPAC name is bis(antimony(3+));N,N,2-tribromoaniline;hexachloride.
Molecular Properties
| Compound Name | bis(antimony(3+));N,N,2-tribromoaniline;hexachloride |
| PubChem CID | 175061094 |
| Molecular Formula | C6H4Br3Cl6NSb2 |
| Molecular Weight | 786.05 g/mol |
| Exact Mass | 778.41 |
| IUPAC Name | bis(antimony(3+));N,N,2-tribromoaniline;hexachloride |
| SMILES | Brc1ccccc1N(Br)Br.[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Sb+3].[Sb+3] |
| InChI | InChI=1S/C6H4Br3N.6ClH.2Sb/c7-5-3-1-2-4-6(5)10(8)9;;;;;;;;/h1-4H;6*1H;;/q;;;;;;;2*+3/p-6 |
| InChIKey | LTFZXVBGJOAGBO-UHFFFAOYSA-H |
| XLogP | -14.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 786.05 |
| LogP ≤ 5 | -14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze bis(antimony(3+));N,N,2-tribromoaniline;hexachloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(antimony(3+));N,N,2-tribromoaniline;hexachloride?
The IUPAC name of bis(antimony(3+));N,N,2-tribromoaniline;hexachloride (CID 175061094) is bis(antimony(3+));N,N,2-tribromoaniline;hexachloride.
What is the SMILES notation for bis(antimony(3+));N,N,2-tribromoaniline;hexachloride?
The canonical SMILES for bis(antimony(3+));N,N,2-tribromoaniline;hexachloride is Brc1ccccc1N(Br)Br.[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Sb+3].[Sb+3].
What is the InChIKey of bis(antimony(3+));N,N,2-tribromoaniline;hexachloride?
The InChIKey is LTFZXVBGJOAGBO-UHFFFAOYSA-H. The full InChI is InChI=1S/C6H4Br3N.6ClH.2Sb/c7-5-3-1-2-4-6(5)10(8)9;;;;;;;;/h1-4H;6*1H;;/q;;;;;;;2*+3/p-6.
What are the key properties of bis(antimony(3+));N,N,2-tribromoaniline;hexachloride?
bis(antimony(3+));N,N,2-tribromoaniline;hexachloride has a molecular weight of 786.05 g/mol, XLogP of -14.86, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(antimony(3+));N,N,2-tribromoaniline;hexachloride is sourced from PubChem (CID 175061094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).