About azane;ditert-butyl 2-(1-bromoethyl)propanedioate
azane;ditert-butyl 2-(1-bromoethyl)propanedioate (PubChem CID 175061151) has the molecular formula C13H26BrNO4
and a molecular weight of 340.26 g/mol. Its IUPAC name is azane;ditert-butyl 2-(1-bromoethyl)propanedioate.
Molecular Properties
| Compound Name | azane;ditert-butyl 2-(1-bromoethyl)propanedioate |
| PubChem CID | 175061151 |
| Molecular Formula | C13H26BrNO4 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | azane;ditert-butyl 2-(1-bromoethyl)propanedioate |
| SMILES | CC(Br)C(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.N |
| InChI | InChI=1S/C13H23BrO4.H3N/c1-8(14)9(10(15)17-12(2,3)4)11(16)18-13(5,6)7;/h8-9H,1-7H3;1H3 |
| InChIKey | YSJSMVYDSJPTAD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze azane;ditert-butyl 2-(1-bromoethyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ditert-butyl 2-(1-bromoethyl)propanedioate?
The IUPAC name of azane;ditert-butyl 2-(1-bromoethyl)propanedioate (CID 175061151) is azane;ditert-butyl 2-(1-bromoethyl)propanedioate.
What is the SMILES notation for azane;ditert-butyl 2-(1-bromoethyl)propanedioate?
The canonical SMILES for azane;ditert-butyl 2-(1-bromoethyl)propanedioate is CC(Br)C(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.N.
What is the InChIKey of azane;ditert-butyl 2-(1-bromoethyl)propanedioate?
The InChIKey is YSJSMVYDSJPTAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23BrO4.H3N/c1-8(14)9(10(15)17-12(2,3)4)11(16)18-13(5,6)7;/h8-9H,1-7H3;1H3.
What are the key properties of azane;ditert-butyl 2-(1-bromoethyl)propanedioate?
azane;ditert-butyl 2-(1-bromoethyl)propanedioate has a molecular weight of 340.26 g/mol, XLogP of 3.23, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ditert-butyl 2-(1-bromoethyl)propanedioate is sourced from PubChem (CID 175061151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).