C33H43N3OS — CID 175061444
2-(2-propoxy-3-undecan-3-ylphenyl)-6-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzonitrile (PubChem CID 175061444) has the molecular formula C33H43N3OS and a molecular weight of 529.79 g/mol. Its IUPAC name is 2-(2-propoxy-3-undecan-3-ylphenyl)-6-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzonitrile.
| Compound Name | 2-(2-propoxy-3-undecan-3-ylphenyl)-6-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 175061444 |
| Molecular Formula | C33H43N3OS |
| Molecular Weight | 529.79 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | 2-(2-propoxy-3-undecan-3-ylphenyl)-6-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzonitrile |
| SMILES | CCCCCCCCC(CC)c1cccc(-c2cccc(-c3nc4c(s3)CNCC4)c2C#N)c1OCCC |
| InChI | InChI=1S/C33H43N3OS/c1-4-7-8-9-10-11-14-24(6-3)25-15-12-17-27(32(25)37-21-5-2)26-16-13-18-28(29(26)22-34)33-36-30-19-20-35-23-31(30)38-33/h12-13,15-18,24,35H,4-11,14,19-21,23H2,1-3H3 |
| InChIKey | IIJGINNVFKQGPB-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.79 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|