About 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium
6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium (PubChem CID 175061858) has the molecular formula C21H26Cl2OZr
and a molecular weight of 456.57 g/mol. Its IUPAC name is 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium.
Molecular Properties
| Compound Name | 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium |
| PubChem CID | 175061858 |
| Molecular Formula | C21H26Cl2OZr |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium |
| SMILES | COc1c(C(C)(C)C)cc2c(c1-c1ccccc1)CC(C)C2.Cl[Zr]Cl |
| InChI | InChI=1S/C21H26O.2ClH.Zr/c1-14-11-16-13-18(21(2,3)4)20(22-5)19(17(16)12-14)15-9-7-6-8-10-15;;;/h6-10,13-14H,11-12H2,1-5H3;2*1H;/q;;;+2/p-2 |
| InChIKey | RMUSPBPVVUUWNH-UHFFFAOYSA-L |
| XLogP | 6.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium?
The IUPAC name of 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium (CID 175061858) is 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium.
What is the SMILES notation for 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium?
The canonical SMILES for 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium is COc1c(C(C)(C)C)cc2c(c1-c1ccccc1)CC(C)C2.Cl[Zr]Cl.
What is the InChIKey of 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium?
The InChIKey is RMUSPBPVVUUWNH-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H26O.2ClH.Zr/c1-14-11-16-13-18(21(2,3)4)20(22-5)19(17(16)12-14)15-9-7-6-8-10-15;;;/h6-10,13-14H,11-12H2,1-5H3;2*1H;/q;;;+2/p-2.
What are the key properties of 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium?
6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium has a molecular weight of 456.57 g/mol, XLogP of 6.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-5-methoxy-2-methyl-4-phenyl-2,3-dihydro-1H-indene;dichlorozirconium is sourced from PubChem (CID 175061858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).