C5H8F5NaO — CID 175062785
sodium;hydride;1,2,3,4,5-pentafluoropentan-1-ol (PubChem CID 175062785) has the molecular formula C5H8F5NaO and a molecular weight of 202.10 g/mol. Its IUPAC name is sodium;hydride;1,2,3,4,5-pentafluoropentan-1-ol.
| Compound Name | sodium;hydride;1,2,3,4,5-pentafluoropentan-1-ol |
|---|---|
| PubChem CID | 175062785 |
| Molecular Formula | C5H8F5NaO |
| Molecular Weight | 202.10 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | sodium;hydride;1,2,3,4,5-pentafluoropentan-1-ol |
| SMILES | OC(F)C(F)C(F)C(F)CF.[H-].[Na+] |
| InChI | InChI=1S/C5H7F5O.Na.H/c6-1-2(7)3(8)4(9)5(10)11;;/h2-5,11H,1H2;;/q;+1;-1 |
| InChIKey | JSINMXFHNCWZCH-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.10 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |