C12H17NO4 — CID 175063252
3-hydroxy-3-methyl-2-(phenylmethoxyamino)butanoic acid (PubChem CID 175063252) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 3-hydroxy-3-methyl-2-(phenylmethoxyamino)butanoic acid.
| Compound Name | 3-hydroxy-3-methyl-2-(phenylmethoxyamino)butanoic acid |
|---|---|
| PubChem CID | 175063252 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-hydroxy-3-methyl-2-(phenylmethoxyamino)butanoic acid |
| SMILES | CC(C)(O)C(NOCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H17NO4/c1-12(2,16)10(11(14)15)13-17-8-9-6-4-3-5-7-9/h3-7,10,13,16H,8H2,1-2H3,(H,14,15) |
| InChIKey | YZLCNJHKRWVOJX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|