C16H24N2O3 — CID 175063335
2-[[benzyl(2-hydroxyethyl)amino]methyl]piperidine-1-carboxylic acid (PubChem CID 175063335) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[[benzyl(2-hydroxyethyl)amino]methyl]piperidine-1-carboxylic acid.
| Compound Name | 2-[[benzyl(2-hydroxyethyl)amino]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175063335 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-[[benzyl(2-hydroxyethyl)amino]methyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCCC1CN(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C16H24N2O3/c19-11-10-17(12-14-6-2-1-3-7-14)13-15-8-4-5-9-18(15)16(20)21/h1-3,6-7,15,19H,4-5,8-13H2,(H,20,21) |
| InChIKey | MVUDUSIEGIMWCO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |