C29H33F2N3O6S — CID 175063546
2-[(2,6-difluorophenyl)methyl-(1-ethoxy-1-oxohexan-2-yl)amino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylic acid (PubChem CID 175063546) has the molecular formula C29H33F2N3O6S and a molecular weight of 589.66 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)methyl-(1-ethoxy-1-oxohexan-2-yl)amino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-[(2,6-difluorophenyl)methyl-(1-ethoxy-1-oxohexan-2-yl)amino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 175063546 |
| Molecular Formula | C29H33F2N3O6S |
| Molecular Weight | 589.66 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | 2-[(2,6-difluorophenyl)methyl-(1-ethoxy-1-oxohexan-2-yl)amino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylic acid |
| SMILES | CCCCC(C(=O)OCC)N(Cc1c(F)cccc1F)c1sc(-c2ccc([N+](=O)[O-])cc2)c(CN(C)C)c1C(=O)O |
| InChI | InChI=1S/C29H33F2N3O6S/c1-5-7-11-24(29(37)40-6-2)33(17-20-22(30)9-8-10-23(20)31)27-25(28(35)36)21(16-32(3)4)26(41-27)18-12-14-19(15-13-18)34(38)39/h8-10,12-15,24H,5-7,11,16-17H2,1-4H3,(H,35,36) |
| InChIKey | IFPQZKCOOUAACW-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|