About 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride
4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride (PubChem CID 175064036) has the molecular formula C17H14Cl2N2O2
and a molecular weight of 349.22 g/mol. Its IUPAC name is 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride |
| PubChem CID | 175064036 |
| Molecular Formula | C17H14Cl2N2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(-[n+]2ccc(-c3ccncc3)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C17H12N2O2.2ClH/c20-17(21)15-1-3-16(4-2-15)19-11-7-14(8-12-19)13-5-9-18-10-6-13;;/h1-12H;2*1H |
| InChIKey | IIDLXCOBLKGAOU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 54.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride?
The IUPAC name of 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride (CID 175064036) is 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride.
What is the SMILES notation for 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride?
The canonical SMILES for 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride is Cl.O=C(O)c1ccc(-[n+]2ccc(-c3ccncc3)cc2)cc1.[Cl-].
What is the InChIKey of 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride?
The InChIKey is IIDLXCOBLKGAOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O2.2ClH/c20-17(21)15-1-3-16(4-2-15)19-11-7-14(8-12-19)13-5-9-18-10-6-13;;/h1-12H;2*1H.
What are the key properties of 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride?
4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride has a molecular weight of 349.22 g/mol, XLogP of 0.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-pyridin-4-ylpyridin-1-ium-1-yl)benzoic acid;chloride;hydrochloride is sourced from PubChem (CID 175064036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).