About (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione
(1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione (PubChem CID 175064301) has the molecular formula C8H11ClOS5
and a molecular weight of 318.96 g/mol. Its IUPAC name is (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione.
Molecular Properties
| Compound Name | (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione |
| PubChem CID | 175064301 |
| Molecular Formula | C8H11ClOS5 |
| Molecular Weight | 318.96 g/mol |
| Exact Mass | 317.91 |
| IUPAC Name | (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione |
| SMILES | CC(C)(SC(=S)S)C(=O)Cl.CC1SC1=S |
| InChI | InChI=1S/C5H7ClOS3.C3H4S2/c1-5(2,3(6)7)10-4(8)9;1-2-3(4)5-2/h1-2H3,(H,8,9);2H,1H3 |
| InChIKey | GGEHZZBMDHQQQZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.96 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione?
The IUPAC name of (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione (CID 175064301) is (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione.
What is the SMILES notation for (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione?
The canonical SMILES for (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione is CC(C)(SC(=S)S)C(=O)Cl.CC1SC1=S.
What is the InChIKey of (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione?
The InChIKey is GGEHZZBMDHQQQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClOS3.C3H4S2/c1-5(2,3(6)7)10-4(8)9;1-2-3(4)5-2/h1-2H3,(H,8,9);2H,1H3.
What are the key properties of (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione?
(1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione has a molecular weight of 318.96 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-chloro-2-methyl-1-oxopropan-2-yl)sulfanylmethanedithioic acid;3-methylthiirane-2-thione is sourced from PubChem (CID 175064301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).