C25H31N3O2 — CID 175064444
4-(2,4-dimethylphenyl)-5-octoxy-2-(1,3,5-triazin-2-yl)phenol (PubChem CID 175064444) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-5-octoxy-2-(1,3,5-triazin-2-yl)phenol.
| Compound Name | 4-(2,4-dimethylphenyl)-5-octoxy-2-(1,3,5-triazin-2-yl)phenol |
|---|---|
| PubChem CID | 175064444 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-5-octoxy-2-(1,3,5-triazin-2-yl)phenol |
| SMILES | CCCCCCCCOc1cc(O)c(-c2ncncn2)cc1-c1ccc(C)cc1C |
| InChI | InChI=1S/C25H31N3O2/c1-4-5-6-7-8-9-12-30-24-15-23(29)22(25-27-16-26-17-28-25)14-21(24)20-11-10-18(2)13-19(20)3/h10-11,13-17,29H,4-9,12H2,1-3H3 |
| InChIKey | YNVZQSXOUPHDIE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|