C26H33N7O4 — CID 175064491
2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-benzyl-4-methyl-3-(1,2,4-triazol-1-yl)pentanamide (PubChem CID 175064491) has the molecular formula C26H33N7O4 and a molecular weight of 507.60 g/mol. Its IUPAC name is 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-benzyl-4-methyl-3-(1,2,4-triazol-1-yl)pentanamide.
| Compound Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-benzyl-4-methyl-3-(1,2,4-triazol-1-yl)pentanamide |
|---|---|
| PubChem CID | 175064491 |
| Molecular Formula | C26H33N7O4 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-benzyl-4-methyl-3-(1,2,4-triazol-1-yl)pentanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/C(C(=O)NCc2ccccc2)C(C(C)C)n2cncn2)cc1OC |
| InChI | InChI=1S/C26H33N7O4/c1-17(2)24(33-16-28-15-30-33)23(25(35)29-14-18-8-6-5-7-9-18)32-26(27)31-22(34)13-19-10-11-20(36-3)21(12-19)37-4/h5-12,15-17,23-24H,13-14H2,1-4H3,(H,29,35)(H3,27,31,32,34) |
| InChIKey | ZHAMESLPRSPIGA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 145.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|