About 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid
3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid (PubChem CID 175064592) has the molecular formula C17H23NO9S2
and a molecular weight of 449.50 g/mol. Its IUPAC name is 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid.
Molecular Properties
| Compound Name | 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid |
| PubChem CID | 175064592 |
| Molecular Formula | C17H23NO9S2 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid |
| SMILES | C[N+](C)(C)CC(O)CC(=O)[O-].O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C10H8O6S2.C7H15NO3/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;1-8(2,3)5-6(9)4-7(10)11/h1-6H,(H,11,12,13)(H,14,15,16);6,9H,4-5H2,1-3H3 |
| InChIKey | MAMDRCZDDHQYDQ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 169.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid?
The IUPAC name of 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid (CID 175064592) is 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid.
What is the SMILES notation for 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid?
The canonical SMILES for 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid is C[N+](C)(C)CC(O)CC(=O)[O-].O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12.
What is the InChIKey of 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid?
The InChIKey is MAMDRCZDDHQYDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O6S2.C7H15NO3/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;1-8(2,3)5-6(9)4-7(10)11/h1-6H,(H,11,12,13)(H,14,15,16);6,9H,4-5H2,1-3H3.
What are the key properties of 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid?
3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid has a molecular weight of 449.50 g/mol, XLogP of -0.47, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4-(trimethylazaniumyl)butanoate;naphthalene-1,5-disulfonic acid is sourced from PubChem (CID 175064592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).