C14H18O8 — CID 175064616
(2R,3R,4S,5S,6R)-6-(1,3-benzodioxol-5-ylmethoxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 175064616) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-(1,3-benzodioxol-5-ylmethoxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-6-(1,3-benzodioxol-5-ylmethoxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 175064616 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-(1,3-benzodioxol-5-ylmethoxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](O)O[C@H](COCc2ccc3c(c2)OCO3)[C@H]1O |
| InChI | InChI=1S/C14H18O8/c15-11-10(22-14(18)13(17)12(11)16)5-19-4-7-1-2-8-9(3-7)21-6-20-8/h1-3,10-18H,4-6H2/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | MXHWSONMFTUDLZ-RKQHYHRCSA-N |
| XLogP | -1.27 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |