About (1-benzylpiperidin-4-yl) butanoate
(1-benzylpiperidin-4-yl) butanoate (PubChem CID 175065089) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl) butanoate.
Molecular Properties
| Compound Name | (1-benzylpiperidin-4-yl) butanoate |
| PubChem CID | 175065089 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (1-benzylpiperidin-4-yl) butanoate |
| SMILES | CCCC(=O)OC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H23NO2/c1-2-6-16(18)19-15-9-11-17(12-10-15)13-14-7-4-3-5-8-14/h3-5,7-8,15H,2,6,9-13H2,1H3 |
| InChIKey | ZAFHXMZIBZJABD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-benzylpiperidin-4-yl) butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzylpiperidin-4-yl) butanoate?
The IUPAC name of (1-benzylpiperidin-4-yl) butanoate (CID 175065089) is (1-benzylpiperidin-4-yl) butanoate.
What is the SMILES notation for (1-benzylpiperidin-4-yl) butanoate?
The canonical SMILES for (1-benzylpiperidin-4-yl) butanoate is CCCC(=O)OC1CCN(Cc2ccccc2)CC1.
What is the InChIKey of (1-benzylpiperidin-4-yl) butanoate?
The InChIKey is ZAFHXMZIBZJABD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-2-6-16(18)19-15-9-11-17(12-10-15)13-14-7-4-3-5-8-14/h3-5,7-8,15H,2,6,9-13H2,1H3.
What are the key properties of (1-benzylpiperidin-4-yl) butanoate?
(1-benzylpiperidin-4-yl) butanoate has a molecular weight of 261.37 g/mol, XLogP of 2.99, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzylpiperidin-4-yl) butanoate is sourced from PubChem (CID 175065089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).