C30H38O6 — CID 175065320
1,7-bis[(E)-hept-2-enyl]-8-hydroxy-2,3,6-trimethoxyxanthen-9-one (PubChem CID 175065320) has the molecular formula C30H38O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is 1,7-bis[(E)-hept-2-enyl]-8-hydroxy-2,3,6-trimethoxyxanthen-9-one.
| Compound Name | 1,7-bis[(E)-hept-2-enyl]-8-hydroxy-2,3,6-trimethoxyxanthen-9-one |
|---|---|
| PubChem CID | 175065320 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 1,7-bis[(E)-hept-2-enyl]-8-hydroxy-2,3,6-trimethoxyxanthen-9-one |
| SMILES | CCCC/C=C/Cc1c(OC)cc2oc3cc(OC)c(OC)c(C/C=C/CCCC)c3c(=O)c2c1O |
| InChI | InChI=1S/C30H38O6/c1-6-8-10-12-14-16-20-22(33-3)18-24-27(28(20)31)29(32)26-21(17-15-13-11-9-7-2)30(35-5)25(34-4)19-23(26)36-24/h12-15,18-19,31H,6-11,16-17H2,1-5H3/b14-12+,15-13+ |
| InChIKey | PCGGJFRKOSUPDI-QUMQEAAQSA-N |
| XLogP | 7.26 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|