C35H25Li — CID 175065645
lithium (1,2,3,4-tetraphenylcyclopenta-2,4-dien-1-yl)benzene (PubChem CID 175065645) has the molecular formula C35H25Li and a molecular weight of 452.53 g/mol. Its IUPAC name is lithium (1,2,3,4-tetraphenylcyclopenta-2,4-dien-1-yl)benzene.
| Compound Name | lithium (1,2,3,4-tetraphenylcyclopenta-2,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 175065645 |
| Molecular Formula | C35H25Li |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | lithium (1,2,3,4-tetraphenylcyclopenta-2,4-dien-1-yl)benzene |
| SMILES | [C-]1=C(c2ccccc2)C(c2ccccc2)=C(c2ccccc2)C1(c1ccccc1)c1ccccc1.[Li+] |
| InChI | InChI=1S/C35H25.Li/c1-6-16-27(17-7-1)32-26-35(30-22-12-4-13-23-30,31-24-14-5-15-25-31)34(29-20-10-3-11-21-29)33(32)28-18-8-2-9-19-28;/h1-25H;/q-1;+1 |
| InChIKey | CNFRWTYQCVWESK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|