About (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate
(4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 175066115) has the molecular formula C17H24FNO5
and a molecular weight of 341.38 g/mol. Its IUPAC name is (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
Molecular Properties
| Compound Name | (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| PubChem CID | 175066115 |
| Molecular Formula | C17H24FNO5 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(CO)C(C)(NC(=O)OC(C)(C)C)C(=O)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C17H24FNO5/c1-11(10-20)17(5,19-15(22)24-16(2,3)4)14(21)23-13-8-6-12(18)7-9-13/h6-9,11,20H,10H2,1-5H3,(H,19,22) |
| InChIKey | PHFHSAKPETVDNS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate?
The IUPAC name of (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CID 175066115) is (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
What is the SMILES notation for (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate?
The canonical SMILES for (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate is CC(CO)C(C)(NC(=O)OC(C)(C)C)C(=O)Oc1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate?
The InChIKey is PHFHSAKPETVDNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24FNO5/c1-11(10-20)17(5,19-15(22)24-16(2,3)4)14(21)23-13-8-6-12(18)7-9-13/h6-9,11,20H,10H2,1-5H3,(H,19,22).
What are the key properties of (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate?
(4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate has a molecular weight of 341.38 g/mol, XLogP of 2.64, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl) 4-hydroxy-2,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate is sourced from PubChem (CID 175066115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).