C25H33NO3 — CID 175066140
[(1R,3S)-1-amino-3-[(6S)-6-[2-(2-methylphenoxy)ethoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol (PubChem CID 175066140) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6S)-6-[2-(2-methylphenoxy)ethoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-1-amino-3-[(6S)-6-[2-(2-methylphenoxy)ethoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 175066140 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6S)-6-[2-(2-methylphenoxy)ethoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
| SMILES | Cc1ccccc1OCCO[C@H]1CCc2cc([C@H]3CC[C@](N)(CO)C3)ccc2C1 |
| InChI | InChI=1S/C25H33NO3/c1-18-4-2-3-5-24(18)29-13-12-28-23-9-8-19-14-20(6-7-21(19)15-23)22-10-11-25(26,16-22)17-27/h2-7,14,22-23,27H,8-13,15-17,26H2,1H3/t22-,23-,25+/m0/s1 |
| InChIKey | TVSWGNMADKNODC-SONWIMMPSA-N |
| XLogP | 3.91 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|