C25H33NO3S — CID 175066376
[(1R,3S)-1-amino-3-[6-[(3,4-dimethoxyphenyl)sulfanylmethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol (PubChem CID 175066376) has the molecular formula C25H33NO3S and a molecular weight of 427.61 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[6-[(3,4-dimethoxyphenyl)sulfanylmethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-1-amino-3-[6-[(3,4-dimethoxyphenyl)sulfanylmethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 175066376 |
| Molecular Formula | C25H33NO3S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | [(1R,3S)-1-amino-3-[6-[(3,4-dimethoxyphenyl)sulfanylmethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
| SMILES | COc1ccc(SCC2CCc3cc([C@H]4CC[C@](N)(CO)C4)ccc3C2)cc1OC |
| InChI | InChI=1S/C25H33NO3S/c1-28-23-8-7-22(13-24(23)29-2)30-15-17-3-4-19-12-20(6-5-18(19)11-17)21-9-10-25(26,14-21)16-27/h5-8,12-13,17,21,27H,3-4,9-11,14-16,26H2,1-2H3/t17?,21-,25+/m0/s1 |
| InChIKey | CCQWGCLWWIGZFL-MHQFRCHTSA-N |
| XLogP | 4.56 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |