C16H10Br2O — CID 175066666
2,3-dibromo-6-naphthalen-2-ylphenol (PubChem CID 175066666) has the molecular formula C16H10Br2O and a molecular weight of 378.06 g/mol. Its IUPAC name is 2,3-dibromo-6-naphthalen-2-ylphenol.
| Compound Name | 2,3-dibromo-6-naphthalen-2-ylphenol |
|---|---|
| PubChem CID | 175066666 |
| Molecular Formula | C16H10Br2O |
| Molecular Weight | 378.06 g/mol |
| Exact Mass | 375.91 |
| IUPAC Name | 2,3-dibromo-6-naphthalen-2-ylphenol |
| SMILES | Oc1c(-c2ccc3ccccc3c2)ccc(Br)c1Br |
| InChI | InChI=1S/C16H10Br2O/c17-14-8-7-13(16(19)15(14)18)12-6-5-10-3-1-2-4-11(10)9-12/h1-9,19H |
| InChIKey | HNLFLDALWMMFEV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.06 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |