About 1H-imidazole;tetrabutylazanium
1H-imidazole;tetrabutylazanium (PubChem CID 175066888) has the molecular formula C19H40N3+
and a molecular weight of 310.55 g/mol. Its IUPAC name is 1H-imidazole;tetrabutylazanium.
Molecular Properties
| Compound Name | 1H-imidazole;tetrabutylazanium |
| PubChem CID | 175066888 |
| Molecular Formula | C19H40N3+ |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.32 |
| IUPAC Name | 1H-imidazole;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.c1c[nH]cn1 |
| InChI | InChI=1S/C16H36N.C3H4N2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-5-3-4-1/h5-16H2,1-4H3;1-3H,(H,4,5)/q+1; |
| InChIKey | INHWAGXLXJACOD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazole;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;tetrabutylazanium?
The IUPAC name of 1H-imidazole;tetrabutylazanium (CID 175066888) is 1H-imidazole;tetrabutylazanium.
What is the SMILES notation for 1H-imidazole;tetrabutylazanium?
The canonical SMILES for 1H-imidazole;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;tetrabutylazanium?
The InChIKey is INHWAGXLXJACOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C3H4N2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-5-3-4-1/h5-16H2,1-4H3;1-3H,(H,4,5)/q+1;.
What are the key properties of 1H-imidazole;tetrabutylazanium?
1H-imidazole;tetrabutylazanium has a molecular weight of 310.55 g/mol, XLogP of 5.41, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;tetrabutylazanium is sourced from PubChem (CID 175066888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).