C23H23NO7S — CID 175066938
[4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]phenyl] [2-(hydroxyamino)-2-oxoethyl] sulfate (PubChem CID 175066938) has the molecular formula C23H23NO7S and a molecular weight of 457.50 g/mol. Its IUPAC name is [4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]phenyl] [2-(hydroxyamino)-2-oxoethyl] sulfate.
| Compound Name | [4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]phenyl] [2-(hydroxyamino)-2-oxoethyl] sulfate |
|---|---|
| PubChem CID | 175066938 |
| Molecular Formula | C23H23NO7S |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [4-[[3-(2,6-dimethylphenyl)phenyl]methoxy]phenyl] [2-(hydroxyamino)-2-oxoethyl] sulfate |
| SMILES | Cc1cccc(C)c1-c1cccc(COc2ccc(OS(=O)(=O)OCC(=O)NO)cc2)c1 |
| InChI | InChI=1S/C23H23NO7S/c1-16-5-3-6-17(2)23(16)19-8-4-7-18(13-19)14-29-20-9-11-21(12-10-20)31-32(27,28)30-15-22(25)24-26/h3-13,26H,14-15H2,1-2H3,(H,24,25) |
| InChIKey | VGJXVGNTPSEHMB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|