About 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one
4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one (PubChem CID 175066952) has the molecular formula C11H17F2NO2
and a molecular weight of 233.26 g/mol. Its IUPAC name is 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one |
| PubChem CID | 175066952 |
| Molecular Formula | C11H17F2NO2 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCN1C(=O)OCC1C(F)C=CF |
| InChI | InChI=1S/C11H17F2NO2/c1-2-3-4-7-14-10(8-16-11(14)15)9(13)5-6-12/h5-6,9-10H,2-4,7-8H2,1H3 |
| InChIKey | KDGQTUZKCUJMQL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one?
The IUPAC name of 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one (CID 175066952) is 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one?
The canonical SMILES for 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one is CCCCCN1C(=O)OCC1C(F)C=CF.
What is the InChIKey of 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one?
The InChIKey is KDGQTUZKCUJMQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2NO2/c1-2-3-4-7-14-10(8-16-11(14)15)9(13)5-6-12/h5-6,9-10H,2-4,7-8H2,1H3.
What are the key properties of 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one?
4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one has a molecular weight of 233.26 g/mol, XLogP of 2.82, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-difluoroprop-2-enyl)-3-pentyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 175066952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).